C21H15F3N4O6S — CID 4311350
2-[[3-nitro-4-[2-[[2-(trifluoromethyl)phenyl]methylidene]hydrazinyl]phenyl]sulfonylamino]benzoic acid (PubChem CID 4311350) has the molecular formula C21H15F3N4O6S and a molecular weight of 508.43 g/mol. Its IUPAC name is 2-[[3-nitro-4-[2-[[2-(trifluoromethyl)phenyl]methylidene]hydrazinyl]phenyl]sulfonylamino]benzoic acid.
| Compound Name | 2-[[3-nitro-4-[2-[[2-(trifluoromethyl)phenyl]methylidene]hydrazinyl]phenyl]sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 4311350 |
| Molecular Formula | C21H15F3N4O6S |
| Molecular Weight | 508.43 g/mol |
| Exact Mass | 508.07 |
| IUPAC Name | 2-[[3-nitro-4-[2-[[2-(trifluoromethyl)phenyl]methylidene]hydrazinyl]phenyl]sulfonylamino]benzoic acid |
| SMILES | O=C(O)c1ccccc1NS(=O)(=O)c1ccc(NN=Cc2ccccc2C(F)(F)F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H15F3N4O6S/c22-21(23,24)16-7-3-1-5-13(16)12-25-26-18-10-9-14(11-19(18)28(31)32)35(33,34)27-17-8-4-2-6-15(17)20(29)30/h1-12,26-27H,(H,29,30) |
| InChIKey | RBPVMSDRIQRSOG-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 151.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.43 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|