C23H24N4O6S — CID 26057808
2-[[4-[(2Z)-2-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methylidene]hydrazinyl]-3-nitrophenyl]sulfonylamino]benzoic acid (PubChem CID 26057808) has the molecular formula C23H24N4O6S and a molecular weight of 484.53 g/mol. Its IUPAC name is 2-[[4-[(2Z)-2-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methylidene]hydrazinyl]-3-nitrophenyl]sulfonylamino]benzoic acid.
| Compound Name | 2-[[4-[(2Z)-2-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methylidene]hydrazinyl]-3-nitrophenyl]sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 26057808 |
| Molecular Formula | C23H24N4O6S |
| Molecular Weight | 484.53 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | 2-[[4-[(2Z)-2-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methylidene]hydrazinyl]-3-nitrophenyl]sulfonylamino]benzoic acid |
| SMILES | CC1(C)[C@H]2CC=C(/C=N\Nc3ccc(S(=O)(=O)Nc4ccccc4C(=O)O)cc3[N+](=O)[O-])[C@@H]1C2 |
| InChI | InChI=1S/C23H24N4O6S/c1-23(2)15-8-7-14(18(23)11-15)13-24-25-20-10-9-16(12-21(20)27(30)31)34(32,33)26-19-6-4-3-5-17(19)22(28)29/h3-7,9-10,12-13,15,18,25-26H,8,11H2,1-2H3,(H,28,29)/b24-13-/t15-,18-/m0/s1 |
| InChIKey | DMMOUGSBZRBCMP-ZUNRSLCNSA-N |
| XLogP | 4.48 |
| TPSA | 151.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.53 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|