C28H27N7O6S — CID 3490670
2-[[4-[2-[(3-methyl-1-phenyl-5-pyrrolidin-1-ylpyrazol-4-yl)methylidene]hydrazinyl]-3-nitrophenyl]sulfonylamino]benzoic acid (PubChem CID 3490670) has the molecular formula C28H27N7O6S and a molecular weight of 589.63 g/mol. Its IUPAC name is 2-[[4-[2-[(3-methyl-1-phenyl-5-pyrrolidin-1-ylpyrazol-4-yl)methylidene]hydrazinyl]-3-nitrophenyl]sulfonylamino]benzoic acid.
| Compound Name | 2-[[4-[2-[(3-methyl-1-phenyl-5-pyrrolidin-1-ylpyrazol-4-yl)methylidene]hydrazinyl]-3-nitrophenyl]sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 3490670 |
| Molecular Formula | C28H27N7O6S |
| Molecular Weight | 589.63 g/mol |
| Exact Mass | 589.17 |
| IUPAC Name | 2-[[4-[2-[(3-methyl-1-phenyl-5-pyrrolidin-1-ylpyrazol-4-yl)methylidene]hydrazinyl]-3-nitrophenyl]sulfonylamino]benzoic acid |
| SMILES | Cc1nn(-c2ccccc2)c(N2CCCC2)c1C=NNc1ccc(S(=O)(=O)Nc2ccccc2C(=O)O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C28H27N7O6S/c1-19-23(27(33-15-7-8-16-33)34(31-19)20-9-3-2-4-10-20)18-29-30-25-14-13-21(17-26(25)35(38)39)42(40,41)32-24-12-6-5-11-22(24)28(36)37/h2-6,9-14,17-18,30,32H,7-8,15-16H2,1H3,(H,36,37) |
| InChIKey | ZJXFOSWIPQPLPI-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 172.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.63 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|