C24H18ClFN6O6S — CID 6530135
2-[[2-[(2Z)-2-[[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]methylidene]hydrazinyl]-5-nitrophenyl]sulfonylamino]benzoic acid (PubChem CID 6530135) has the molecular formula C24H18ClFN6O6S and a molecular weight of 572.96 g/mol. Its IUPAC name is 2-[[2-[(2Z)-2-[[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]methylidene]hydrazinyl]-5-nitrophenyl]sulfonylamino]benzoic acid.
| Compound Name | 2-[[2-[(2Z)-2-[[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]methylidene]hydrazinyl]-5-nitrophenyl]sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 6530135 |
| Molecular Formula | C24H18ClFN6O6S |
| Molecular Weight | 572.96 g/mol |
| Exact Mass | 572.07 |
| IUPAC Name | 2-[[2-[(2Z)-2-[[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]methylidene]hydrazinyl]-5-nitrophenyl]sulfonylamino]benzoic acid |
| SMILES | Cc1nn(-c2ccc(F)cc2)c(Cl)c1/C=N\Nc1ccc([N+](=O)[O-])cc1S(=O)(=O)Nc1ccccc1C(=O)O |
| InChI | InChI=1S/C24H18ClFN6O6S/c1-14-19(23(25)31(29-14)16-8-6-15(26)7-9-16)13-27-28-21-11-10-17(32(35)36)12-22(21)39(37,38)30-20-5-3-2-4-18(20)24(33)34/h2-13,28,30H,1H3,(H,33,34)/b27-13- |
| InChIKey | JPHGXYNGGCIUDO-WKIKZPBSSA-N |
| XLogP | 4.83 |
| TPSA | 168.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.96 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|