C27H26ClN7O4S — CID 4830839
N-(4-chlorophenyl)-2-[2-[(3-methyl-1-phenyl-5-pyrrolidin-1-ylpyrazol-4-yl)methylidene]hydrazinyl]-5-nitrobenzenesulfonamide (PubChem CID 4830839) has the molecular formula C27H26ClN7O4S and a molecular weight of 580.07 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[2-[(3-methyl-1-phenyl-5-pyrrolidin-1-ylpyrazol-4-yl)methylidene]hydrazinyl]-5-nitrobenzenesulfonamide.
| Compound Name | N-(4-chlorophenyl)-2-[2-[(3-methyl-1-phenyl-5-pyrrolidin-1-ylpyrazol-4-yl)methylidene]hydrazinyl]-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 4830839 |
| Molecular Formula | C27H26ClN7O4S |
| Molecular Weight | 580.07 g/mol |
| Exact Mass | 579.15 |
| IUPAC Name | N-(4-chlorophenyl)-2-[2-[(3-methyl-1-phenyl-5-pyrrolidin-1-ylpyrazol-4-yl)methylidene]hydrazinyl]-5-nitrobenzenesulfonamide |
| SMILES | Cc1nn(-c2ccccc2)c(N2CCCC2)c1C=NNc1ccc([N+](=O)[O-])cc1S(=O)(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H26ClN7O4S/c1-19-24(27(33-15-5-6-16-33)34(31-19)22-7-3-2-4-8-22)18-29-30-25-14-13-23(35(36)37)17-26(25)40(38,39)32-21-11-9-20(28)10-12-21/h2-4,7-14,17-18,30,32H,5-6,15-16H2,1H3 |
| InChIKey | WAGOQCHPKMENPR-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 134.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.07 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|