C25H22N6O6S — CID 4841574
2-[[4-[2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methylidene]hydrazinyl]-3-nitrophenyl]sulfonylamino]benzoic acid (PubChem CID 4841574) has the molecular formula C25H22N6O6S and a molecular weight of 534.55 g/mol. Its IUPAC name is 2-[[4-[2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methylidene]hydrazinyl]-3-nitrophenyl]sulfonylamino]benzoic acid.
| Compound Name | 2-[[4-[2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methylidene]hydrazinyl]-3-nitrophenyl]sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 4841574 |
| Molecular Formula | C25H22N6O6S |
| Molecular Weight | 534.55 g/mol |
| Exact Mass | 534.13 |
| IUPAC Name | 2-[[4-[2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methylidene]hydrazinyl]-3-nitrophenyl]sulfonylamino]benzoic acid |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1C=NNc1ccc(S(=O)(=O)Nc2ccccc2C(=O)O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H22N6O6S/c1-16-21(17(2)30(28-16)18-8-4-3-5-9-18)15-26-27-23-13-12-19(14-24(23)31(34)35)38(36,37)29-22-11-7-6-10-20(22)25(32)33/h3-15,27,29H,1-2H3,(H,32,33) |
| InChIKey | QZWDRHVWGSRZHI-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 168.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.55 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|