C18H15N7O6 — CID 126007812
N-[(E)-[3,5-dimethyl-1-(3-nitrophenyl)pyrazol-4-yl]methylideneamino]-2,4-dinitroaniline (PubChem CID 126007812) has the molecular formula C18H15N7O6 and a molecular weight of 425.36 g/mol. Its IUPAC name is N-[(E)-[3,5-dimethyl-1-(3-nitrophenyl)pyrazol-4-yl]methylideneamino]-2,4-dinitroaniline.
| Compound Name | N-[(E)-[3,5-dimethyl-1-(3-nitrophenyl)pyrazol-4-yl]methylideneamino]-2,4-dinitroaniline |
|---|---|
| PubChem CID | 126007812 |
| Molecular Formula | C18H15N7O6 |
| Molecular Weight | 425.36 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | N-[(E)-[3,5-dimethyl-1-(3-nitrophenyl)pyrazol-4-yl]methylideneamino]-2,4-dinitroaniline |
| SMILES | Cc1nn(-c2cccc([N+](=O)[O-])c2)c(C)c1/C=N/Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H15N7O6/c1-11-16(12(2)22(21-11)13-4-3-5-14(8-13)23(26)27)10-19-20-17-7-6-15(24(28)29)9-18(17)25(30)31/h3-10,20H,1-2H3/b19-10+ |
| InChIKey | VIMXAXALVQZNCO-VXLYETTFSA-N |
| XLogP | 3.66 |
| TPSA | 171.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.36 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|