C24H22N8O8 — CID 3936149
N-[[4-[[(2,4-dinitrophenyl)hydrazinylidene]methyl]-2,3,5,6-tetramethylphenyl]methylideneamino]-2,4-dinitroaniline (PubChem CID 3936149) has the molecular formula C24H22N8O8 and a molecular weight of 550.49 g/mol. Its IUPAC name is N-[[4-[[(2,4-dinitrophenyl)hydrazinylidene]methyl]-2,3,5,6-tetramethylphenyl]methylideneamino]-2,4-dinitroaniline.
| Compound Name | N-[[4-[[(2,4-dinitrophenyl)hydrazinylidene]methyl]-2,3,5,6-tetramethylphenyl]methylideneamino]-2,4-dinitroaniline |
|---|---|
| PubChem CID | 3936149 |
| Molecular Formula | C24H22N8O8 |
| Molecular Weight | 550.49 g/mol |
| Exact Mass | 550.16 |
| IUPAC Name | N-[[4-[[(2,4-dinitrophenyl)hydrazinylidene]methyl]-2,3,5,6-tetramethylphenyl]methylideneamino]-2,4-dinitroaniline |
| SMILES | Cc1c(C)c(C=NNc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c(C)c(C)c1C=NNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H22N8O8/c1-13-14(2)20(12-26-28-22-8-6-18(30(35)36)10-24(22)32(39)40)16(4)15(3)19(13)11-25-27-21-7-5-17(29(33)34)9-23(21)31(37)38/h5-12,27-28H,1-4H3 |
| InChIKey | LXGFIZURMTYBMM-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 221.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.49 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|