C10H11ClN4O4 — CID 22764781
N-[(E)-(2-chloro-2-methylpropylidene)amino]-2,4-dinitroaniline (PubChem CID 22764781) has the molecular formula C10H11ClN4O4 and a molecular weight of 286.68 g/mol. Its IUPAC name is N-[(E)-(2-chloro-2-methylpropylidene)amino]-2,4-dinitroaniline.
| Compound Name | N-[(E)-(2-chloro-2-methylpropylidene)amino]-2,4-dinitroaniline |
|---|---|
| PubChem CID | 22764781 |
| Molecular Formula | C10H11ClN4O4 |
| Molecular Weight | 286.68 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | N-[(E)-(2-chloro-2-methylpropylidene)amino]-2,4-dinitroaniline |
| SMILES | CC(C)(Cl)/C=N/Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H11ClN4O4/c1-10(2,11)6-12-13-8-4-3-7(14(16)17)5-9(8)15(18)19/h3-6,13H,1-2H3/b12-6+ |
| InChIKey | SJVTXOKPIFAWAO-WUXMJOGZSA-N |
| XLogP | 2.92 |
| TPSA | 110.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.68 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|