C10H12N4O4S — CID 92529730
N-[(E)-[(2S)-2-methylsulfanylpropylidene]amino]-2,4-dinitroaniline (PubChem CID 92529730) has the molecular formula C10H12N4O4S and a molecular weight of 284.30 g/mol. Its IUPAC name is N-[(E)-[(2S)-2-methylsulfanylpropylidene]amino]-2,4-dinitroaniline.
| Compound Name | N-[(E)-[(2S)-2-methylsulfanylpropylidene]amino]-2,4-dinitroaniline |
|---|---|
| PubChem CID | 92529730 |
| Molecular Formula | C10H12N4O4S |
| Molecular Weight | 284.30 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | N-[(E)-[(2S)-2-methylsulfanylpropylidene]amino]-2,4-dinitroaniline |
| SMILES | CS[C@@H](C)/C=N/Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H12N4O4S/c1-7(19-2)6-11-12-9-4-3-8(13(15)16)5-10(9)14(17)18/h3-7,12H,1-2H3/b11-6+/t7-/m0/s1 |
| InChIKey | MDTLCKSUWLYASZ-KEXZDQNZSA-N |
| XLogP | 2.65 |
| TPSA | 110.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.30 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|