C9H11N5O4 — CID 22462640
N-[(E)-3-aminopropylideneamino]-2,4-dinitroaniline (PubChem CID 22462640) has the molecular formula C9H11N5O4 and a molecular weight of 253.22 g/mol. Its IUPAC name is N-[(E)-3-aminopropylideneamino]-2,4-dinitroaniline.
| Compound Name | N-[(E)-3-aminopropylideneamino]-2,4-dinitroaniline |
|---|---|
| PubChem CID | 22462640 |
| Molecular Formula | C9H11N5O4 |
| Molecular Weight | 253.22 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | N-[(E)-3-aminopropylideneamino]-2,4-dinitroaniline |
| SMILES | NCC/C=N/Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H11N5O4/c10-4-1-5-11-12-8-3-2-7(13(15)16)6-9(8)14(17)18/h2-3,5-6,12H,1,4,10H2/b11-5+ |
| InChIKey | NHBSVPXJORYUSR-VZUCSPMQSA-N |
| XLogP | 1.25 |
| TPSA | 136.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.22 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|