C11H10N4O4 — CID 131855224
2,4-dinitro-N-(penta-3,4-dienylideneamino)aniline (PubChem CID 131855224) has the molecular formula C11H10N4O4 and a molecular weight of 262.23 g/mol. Its IUPAC name is 2,4-dinitro-N-(penta-3,4-dienylideneamino)aniline.
| Compound Name | 2,4-dinitro-N-(penta-3,4-dienylideneamino)aniline |
|---|---|
| PubChem CID | 131855224 |
| Molecular Formula | C11H10N4O4 |
| Molecular Weight | 262.23 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | 2,4-dinitro-N-(penta-3,4-dienylideneamino)aniline |
| SMILES | C=C=CCC=NNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H10N4O4/c1-2-3-4-7-12-13-10-6-5-9(14(16)17)8-11(10)15(18)19/h3,5-8,13H,1,4H2 |
| InChIKey | RQKZSZNDJAFABU-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 110.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.23 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|