C11H15N7O4 — CID 71322336
2-[4-[(2,4-dinitrophenyl)hydrazinylidene]butyl]guanidine (PubChem CID 71322336) has the molecular formula C11H15N7O4 and a molecular weight of 309.29 g/mol. Its IUPAC name is 2-[4-[(2,4-dinitrophenyl)hydrazinylidene]butyl]guanidine.
| Compound Name | 2-[4-[(2,4-dinitrophenyl)hydrazinylidene]butyl]guanidine |
|---|---|
| PubChem CID | 71322336 |
| Molecular Formula | C11H15N7O4 |
| Molecular Weight | 309.29 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | 2-[4-[(2,4-dinitrophenyl)hydrazinylidene]butyl]guanidine |
| SMILES | NC(N)=NCCCC=NNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H15N7O4/c12-11(13)14-5-1-2-6-15-16-9-4-3-8(17(19)20)7-10(9)18(21)22/h3-4,6-7,16H,1-2,5H2,(H4,12,13,14) |
| InChIKey | CGBRELDBCPLCRK-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 175.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.29 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|