C10H10N4O6 — CID 15107201
(4E)-4-[(2,4-dinitrophenyl)hydrazinylidene]butanoic acid (PubChem CID 15107201) has the molecular formula C10H10N4O6 and a molecular weight of 282.21 g/mol. Its IUPAC name is (4E)-4-[(2,4-dinitrophenyl)hydrazinylidene]butanoic acid.
| Compound Name | (4E)-4-[(2,4-dinitrophenyl)hydrazinylidene]butanoic acid |
|---|---|
| PubChem CID | 15107201 |
| Molecular Formula | C10H10N4O6 |
| Molecular Weight | 282.21 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | (4E)-4-[(2,4-dinitrophenyl)hydrazinylidene]butanoic acid |
| SMILES | O=C(O)CC/C=N/Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H10N4O6/c15-10(16)2-1-5-11-12-8-4-3-7(13(17)18)6-9(8)14(19)20/h3-6,12H,1-2H2,(H,15,16)/b11-5+ |
| InChIKey | XIQVJSLOJWLIKA-VZUCSPMQSA-N |
| XLogP | 1.77 |
| TPSA | 147.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.21 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|