C10H9N5O7 — CID 71424197
2-[[2-[(2,4-dinitrophenyl)hydrazinylidene]acetyl]amino]acetic acid (PubChem CID 71424197) has the molecular formula C10H9N5O7 and a molecular weight of 311.21 g/mol. Its IUPAC name is 2-[[2-[(2,4-dinitrophenyl)hydrazinylidene]acetyl]amino]acetic acid.
| Compound Name | 2-[[2-[(2,4-dinitrophenyl)hydrazinylidene]acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 71424197 |
| Molecular Formula | C10H9N5O7 |
| Molecular Weight | 311.21 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | 2-[[2-[(2,4-dinitrophenyl)hydrazinylidene]acetyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)C=NNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H9N5O7/c16-9(11-5-10(17)18)4-12-13-7-2-1-6(14(19)20)3-8(7)15(21)22/h1-4,13H,5H2,(H,11,16)(H,17,18) |
| InChIKey | VMQFLWQUZCLIRU-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 177.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.21 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|