C17H16N8O11 — CID 98513666
(2R,3S,4Z,5E)-4,5-bis[(2,4-dinitrophenyl)hydrazinylidene]pentane-1,2,3-triol (PubChem CID 98513666) has the molecular formula C17H16N8O11 and a molecular weight of 508.36 g/mol. Its IUPAC name is (2R,3S,4Z,5E)-4,5-bis[(2,4-dinitrophenyl)hydrazinylidene]pentane-1,2,3-triol.
| Compound Name | (2R,3S,4Z,5E)-4,5-bis[(2,4-dinitrophenyl)hydrazinylidene]pentane-1,2,3-triol |
|---|---|
| PubChem CID | 98513666 |
| Molecular Formula | C17H16N8O11 |
| Molecular Weight | 508.36 g/mol |
| Exact Mass | 508.09 |
| IUPAC Name | (2R,3S,4Z,5E)-4,5-bis[(2,4-dinitrophenyl)hydrazinylidene]pentane-1,2,3-triol |
| SMILES | O=[N+]([O-])c1ccc(N/N=C(/C=N/Nc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])[C@H](O)[C@H](O)CO)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H16N8O11/c26-8-16(27)17(28)13(21-20-12-4-2-10(23(31)32)6-15(12)25(35)36)7-18-19-11-3-1-9(22(29)30)5-14(11)24(33)34/h1-7,16-17,19-20,26-28H,8H2/b18-7+,21-13-/t16-,17+/m1/s1 |
| InChIKey | UMAJJJSOJUAUFJ-OMVMJAPTSA-N |
| XLogP | 0.90 |
| TPSA | 282.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.36 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|