C9H10N4O5 — CID 171042675
(2E)-2-[(2,4-dinitrophenyl)hydrazinylidene]propan-1-ol (PubChem CID 171042675) has the molecular formula C9H10N4O5 and a molecular weight of 254.20 g/mol. Its IUPAC name is (2E)-2-[(2,4-dinitrophenyl)hydrazinylidene]propan-1-ol.
| Compound Name | (2E)-2-[(2,4-dinitrophenyl)hydrazinylidene]propan-1-ol |
|---|---|
| PubChem CID | 171042675 |
| Molecular Formula | C9H10N4O5 |
| Molecular Weight | 254.20 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | (2E)-2-[(2,4-dinitrophenyl)hydrazinylidene]propan-1-ol |
| SMILES | C/C(CO)=N\Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H10N4O5/c1-6(5-14)10-11-8-3-2-7(12(15)16)4-9(8)13(17)18/h2-4,11,14H,5H2,1H3/b10-6+ |
| InChIKey | OKMYRYWRPTZQRR-UXBLZVDNSA-N |
| XLogP | 1.28 |
| TPSA | 130.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.20 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|