C11H16N4O10P2 — CID 10455130
N-[bis(dimethoxyphosphoryl)methylideneamino]-2,4-dinitroaniline (PubChem CID 10455130) has the molecular formula C11H16N4O10P2 and a molecular weight of 426.22 g/mol. Its IUPAC name is N-[bis(dimethoxyphosphoryl)methylideneamino]-2,4-dinitroaniline.
| Compound Name | N-[bis(dimethoxyphosphoryl)methylideneamino]-2,4-dinitroaniline |
|---|---|
| PubChem CID | 10455130 |
| Molecular Formula | C11H16N4O10P2 |
| Molecular Weight | 426.22 g/mol |
| Exact Mass | 426.03 |
| IUPAC Name | N-[bis(dimethoxyphosphoryl)methylideneamino]-2,4-dinitroaniline |
| SMILES | COP(=O)(OC)C(=NNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])P(=O)(OC)OC |
| InChI | InChI=1S/C11H16N4O10P2/c1-22-26(20,23-2)11(27(21,24-3)25-4)13-12-9-6-5-8(14(16)17)7-10(9)15(18)19/h5-7,12H,1-4H3 |
| InChIKey | LWFDUOUUPUJBQM-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 181.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.22 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|