C10H14N4O10P2 — CID 10094435
[(Z)-C-dimethoxyphosphoryl-N-(2,4-dinitroanilino)carbonimidoyl]-methoxyphosphinic acid (PubChem CID 10094435) has the molecular formula C10H14N4O10P2 and a molecular weight of 412.19 g/mol. Its IUPAC name is [(Z)-C-dimethoxyphosphoryl-N-(2,4-dinitroanilino)carbonimidoyl]-methoxyphosphinic acid.
| Compound Name | [(Z)-C-dimethoxyphosphoryl-N-(2,4-dinitroanilino)carbonimidoyl]-methoxyphosphinic acid |
|---|---|
| PubChem CID | 10094435 |
| Molecular Formula | C10H14N4O10P2 |
| Molecular Weight | 412.19 g/mol |
| Exact Mass | 412.02 |
| IUPAC Name | [(Z)-C-dimethoxyphosphoryl-N-(2,4-dinitroanilino)carbonimidoyl]-methoxyphosphinic acid |
| SMILES | COP(=O)(O)/C(=N/Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])P(=O)(OC)OC |
| InChI | InChI=1S/C10H14N4O10P2/c1-22-25(19,20)10(26(21,23-2)24-3)12-11-8-5-4-7(13(15)16)6-9(8)14(17)18/h4-6,11H,1-3H3,(H,19,20)/b12-10- |
| InChIKey | ZVMADYQJAVFOJV-BENRWUELSA-N |
| XLogP | 2.50 |
| TPSA | 192.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.19 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|