C15H13N5O7 — CID 3493756
N-[1-(4-methoxy-3-nitrophenyl)ethylideneamino]-2,4-dinitroaniline (PubChem CID 3493756) has the molecular formula C15H13N5O7 and a molecular weight of 375.30 g/mol. Its IUPAC name is N-[1-(4-methoxy-3-nitrophenyl)ethylideneamino]-2,4-dinitroaniline.
| Compound Name | N-[1-(4-methoxy-3-nitrophenyl)ethylideneamino]-2,4-dinitroaniline |
|---|---|
| PubChem CID | 3493756 |
| Molecular Formula | C15H13N5O7 |
| Molecular Weight | 375.30 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | N-[1-(4-methoxy-3-nitrophenyl)ethylideneamino]-2,4-dinitroaniline |
| SMILES | COc1ccc(C(C)=NNc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H13N5O7/c1-9(10-3-6-15(27-2)14(7-10)20(25)26)16-17-12-5-4-11(18(21)22)8-13(12)19(23)24/h3-8,17H,1-2H3 |
| InChIKey | SNGOGHJPTYIINA-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 163.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.30 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|