C16H16N4O6 — CID 6041104
N-[(Z)-1-(2,3-dimethoxyphenyl)ethylideneamino]-2,4-dinitroaniline (PubChem CID 6041104) has the molecular formula C16H16N4O6 and a molecular weight of 360.33 g/mol. Its IUPAC name is N-[(Z)-1-(2,3-dimethoxyphenyl)ethylideneamino]-2,4-dinitroaniline.
| Compound Name | N-[(Z)-1-(2,3-dimethoxyphenyl)ethylideneamino]-2,4-dinitroaniline |
|---|---|
| PubChem CID | 6041104 |
| Molecular Formula | C16H16N4O6 |
| Molecular Weight | 360.33 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | N-[(Z)-1-(2,3-dimethoxyphenyl)ethylideneamino]-2,4-dinitroaniline |
| SMILES | COc1cccc(/C(C)=N\Nc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c1OC |
| InChI | InChI=1S/C16H16N4O6/c1-10(12-5-4-6-15(25-2)16(12)26-3)17-18-13-8-7-11(19(21)22)9-14(13)20(23)24/h4-9,18H,1-3H3/b17-10- |
| InChIKey | WXYSMXYJGTUADD-YVLHZVERSA-N |
| XLogP | 3.36 |
| TPSA | 129.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.33 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|