C14H11ClN4O4 — CID 6138465
N-[(Z)-1-(4-chlorophenyl)ethylideneamino]-2,4-dinitroaniline (PubChem CID 6138465) has the molecular formula C14H11ClN4O4 and a molecular weight of 334.72 g/mol. Its IUPAC name is N-[(Z)-1-(4-chlorophenyl)ethylideneamino]-2,4-dinitroaniline.
| Compound Name | N-[(Z)-1-(4-chlorophenyl)ethylideneamino]-2,4-dinitroaniline |
|---|---|
| PubChem CID | 6138465 |
| Molecular Formula | C14H11ClN4O4 |
| Molecular Weight | 334.72 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | N-[(Z)-1-(4-chlorophenyl)ethylideneamino]-2,4-dinitroaniline |
| SMILES | C/C(=N/Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H11ClN4O4/c1-9(10-2-4-11(15)5-3-10)16-17-13-7-6-12(18(20)21)8-14(13)19(22)23/h2-8,17H,1H3/b16-9- |
| InChIKey | FGXAJBJQNKMONT-SXGWCWSVSA-N |
| XLogP | 3.99 |
| TPSA | 110.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.72 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|