C19H15ClN5O4+ — CID 6048573
N-[(Z)-[1-(4-chlorophenyl)-2-pyridin-1-ium-1-ylethylidene]amino]-2,4-dinitroaniline (PubChem CID 6048573) has the molecular formula C19H15ClN5O4+ and a molecular weight of 412.81 g/mol. Its IUPAC name is N-[(Z)-[1-(4-chlorophenyl)-2-pyridin-1-ium-1-ylethylidene]amino]-2,4-dinitroaniline.
| Compound Name | N-[(Z)-[1-(4-chlorophenyl)-2-pyridin-1-ium-1-ylethylidene]amino]-2,4-dinitroaniline |
|---|---|
| PubChem CID | 6048573 |
| Molecular Formula | C19H15ClN5O4+ |
| Molecular Weight | 412.81 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | N-[(Z)-[1-(4-chlorophenyl)-2-pyridin-1-ium-1-ylethylidene]amino]-2,4-dinitroaniline |
| SMILES | O=[N+]([O-])c1ccc(N/N=C(\C[n+]2ccccc2)c2ccc(Cl)cc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H15ClN5O4/c20-15-6-4-14(5-7-15)18(13-23-10-2-1-3-11-23)22-21-17-9-8-16(24(26)27)12-19(17)25(28)29/h1-12,21H,13H2/q+1/b22-18+ |
| InChIKey | HATVDGBASMYWTH-RELWKKBWSA-N |
| XLogP | 3.96 |
| TPSA | 114.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.81 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|