C16H16N4O4 — CID 6105223
2,4-dinitro-N-[(Z)-1-phenylbutylideneamino]aniline (PubChem CID 6105223) has the molecular formula C16H16N4O4 and a molecular weight of 328.33 g/mol. Its IUPAC name is 2,4-dinitro-N-[(Z)-1-phenylbutylideneamino]aniline.
| Compound Name | 2,4-dinitro-N-[(Z)-1-phenylbutylideneamino]aniline |
|---|---|
| PubChem CID | 6105223 |
| Molecular Formula | C16H16N4O4 |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 2,4-dinitro-N-[(Z)-1-phenylbutylideneamino]aniline |
| SMILES | CCC/C(=N/Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C16H16N4O4/c1-2-6-14(12-7-4-3-5-8-12)17-18-15-10-9-13(19(21)22)11-16(15)20(23)24/h3-5,7-11,18H,2,6H2,1H3/b17-14- |
| InChIKey | IRINKFVZVBARKS-VKAVYKQESA-N |
| XLogP | 4.12 |
| TPSA | 110.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|