C16H14N4O6 — CID 6306782
(4Z)-4-[(2,4-dinitrophenyl)hydrazinylidene]-4-phenylbutanoic acid (PubChem CID 6306782) has the molecular formula C16H14N4O6 and a molecular weight of 358.31 g/mol. Its IUPAC name is (4Z)-4-[(2,4-dinitrophenyl)hydrazinylidene]-4-phenylbutanoic acid.
| Compound Name | (4Z)-4-[(2,4-dinitrophenyl)hydrazinylidene]-4-phenylbutanoic acid |
|---|---|
| PubChem CID | 6306782 |
| Molecular Formula | C16H14N4O6 |
| Molecular Weight | 358.31 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | (4Z)-4-[(2,4-dinitrophenyl)hydrazinylidene]-4-phenylbutanoic acid |
| SMILES | O=C(O)CC/C(=N/Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C16H14N4O6/c21-16(22)9-8-13(11-4-2-1-3-5-11)17-18-14-7-6-12(19(23)24)10-15(14)20(25)26/h1-7,10,18H,8-9H2,(H,21,22)/b17-13- |
| InChIKey | TUHZOEGNBYUDRX-LGMDPLHJSA-N |
| XLogP | 3.18 |
| TPSA | 147.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.31 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|