C29H23N5O7 — CID 9499650
[(2Z)-2-[(2,4-dinitrophenyl)hydrazinylidene]-2-phenylethyl] (2S)-2-benzamido-2-phenylacetate (PubChem CID 9499650) has the molecular formula C29H23N5O7 and a molecular weight of 553.53 g/mol. Its IUPAC name is [(2Z)-2-[(2,4-dinitrophenyl)hydrazinylidene]-2-phenylethyl] (2S)-2-benzamido-2-phenylacetate.
| Compound Name | [(2Z)-2-[(2,4-dinitrophenyl)hydrazinylidene]-2-phenylethyl] (2S)-2-benzamido-2-phenylacetate |
|---|---|
| PubChem CID | 9499650 |
| Molecular Formula | C29H23N5O7 |
| Molecular Weight | 553.53 g/mol |
| Exact Mass | 553.16 |
| IUPAC Name | [(2Z)-2-[(2,4-dinitrophenyl)hydrazinylidene]-2-phenylethyl] (2S)-2-benzamido-2-phenylacetate |
| SMILES | O=C(N[C@H](C(=O)OC/C(=N\Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H23N5O7/c35-28(22-14-8-3-9-15-22)30-27(21-12-6-2-7-13-21)29(36)41-19-25(20-10-4-1-5-11-20)32-31-24-17-16-23(33(37)38)18-26(24)34(39)40/h1-18,27,31H,19H2,(H,30,35)/b32-25+/t27-/m0/s1 |
| InChIKey | MCIDWFNYLZHJJJ-IHTNELIXSA-N |
| XLogP | 5.03 |
| TPSA | 166.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.53 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|