C30H25N5O7 — CID 98045045
[(2Z)-2-[(2,4-dinitrophenyl)hydrazinylidene]-2-phenylethyl] (3S)-3-benzamido-3-phenylpropanoate (PubChem CID 98045045) has the molecular formula C30H25N5O7 and a molecular weight of 567.56 g/mol. Its IUPAC name is [(2Z)-2-[(2,4-dinitrophenyl)hydrazinylidene]-2-phenylethyl] (3S)-3-benzamido-3-phenylpropanoate.
| Compound Name | [(2Z)-2-[(2,4-dinitrophenyl)hydrazinylidene]-2-phenylethyl] (3S)-3-benzamido-3-phenylpropanoate |
|---|---|
| PubChem CID | 98045045 |
| Molecular Formula | C30H25N5O7 |
| Molecular Weight | 567.56 g/mol |
| Exact Mass | 567.18 |
| IUPAC Name | [(2Z)-2-[(2,4-dinitrophenyl)hydrazinylidene]-2-phenylethyl] (3S)-3-benzamido-3-phenylpropanoate |
| SMILES | O=C(C[C@H](NC(=O)c1ccccc1)c1ccccc1)OC/C(=N\Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C30H25N5O7/c36-29(19-26(21-10-4-1-5-11-21)31-30(37)23-14-8-3-9-15-23)42-20-27(22-12-6-2-7-13-22)33-32-25-17-16-24(34(38)39)18-28(25)35(40)41/h1-18,26,32H,19-20H2,(H,31,37)/b33-27+/t26-/m0/s1 |
| InChIKey | RNSDLMVJKYSMLI-NRJOLUBPSA-N |
| XLogP | 5.42 |
| TPSA | 166.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.56 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|