C16H16N4O5 — CID 134094248
N-[(E)-(2-ethoxy-1-phenylethylidene)amino]-2,4-dinitroaniline (PubChem CID 134094248) has the molecular formula C16H16N4O5 and a molecular weight of 344.33 g/mol. Its IUPAC name is N-[(E)-(2-ethoxy-1-phenylethylidene)amino]-2,4-dinitroaniline.
| Compound Name | N-[(E)-(2-ethoxy-1-phenylethylidene)amino]-2,4-dinitroaniline |
|---|---|
| PubChem CID | 134094248 |
| Molecular Formula | C16H16N4O5 |
| Molecular Weight | 344.33 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | N-[(E)-(2-ethoxy-1-phenylethylidene)amino]-2,4-dinitroaniline |
| SMILES | CCOC/C(=N/Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C16H16N4O5/c1-2-25-11-15(12-6-4-3-5-7-12)18-17-14-9-8-13(19(21)22)10-16(14)20(23)24/h3-10,17H,2,11H2,1H3/b18-15- |
| InChIKey | RCQXCDKKTMHXRT-SDXDJHTJSA-N |
| XLogP | 3.36 |
| TPSA | 119.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.33 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|