C27H28N4O6 — CID 5478191
[(2E)-2-[(2,4-dinitrophenyl)hydrazinylidene]-2-(4-phenylphenyl)ethyl] 3-ethylpentanoate (PubChem CID 5478191) has the molecular formula C27H28N4O6 and a molecular weight of 504.54 g/mol. Its IUPAC name is [(2E)-2-[(2,4-dinitrophenyl)hydrazinylidene]-2-(4-phenylphenyl)ethyl] 3-ethylpentanoate.
| Compound Name | [(2E)-2-[(2,4-dinitrophenyl)hydrazinylidene]-2-(4-phenylphenyl)ethyl] 3-ethylpentanoate |
|---|---|
| PubChem CID | 5478191 |
| Molecular Formula | C27H28N4O6 |
| Molecular Weight | 504.54 g/mol |
| Exact Mass | 504.20 |
| IUPAC Name | [(2E)-2-[(2,4-dinitrophenyl)hydrazinylidene]-2-(4-phenylphenyl)ethyl] 3-ethylpentanoate |
| SMILES | CCC(CC)CC(=O)OC/C(=N/Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C27H28N4O6/c1-3-19(4-2)16-27(32)37-18-25(22-12-10-21(11-13-22)20-8-6-5-7-9-20)29-28-24-15-14-23(30(33)34)17-26(24)31(35)36/h5-15,17,19,28H,3-4,16,18H2,1-2H3/b29-25- |
| InChIKey | APHSEGRLWXGHLK-GNVQSUKOSA-N |
| XLogP | 6.36 |
| TPSA | 136.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.54 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|