C12H14N4O6 — CID 14777756
(2Z)-2-[(2,4-dinitrophenyl)hydrazinylidene]-3-methylpentanoic acid (PubChem CID 14777756) has the molecular formula C12H14N4O6 and a molecular weight of 310.27 g/mol. Its IUPAC name is (2Z)-2-[(2,4-dinitrophenyl)hydrazinylidene]-3-methylpentanoic acid.
| Compound Name | (2Z)-2-[(2,4-dinitrophenyl)hydrazinylidene]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 14777756 |
| Molecular Formula | C12H14N4O6 |
| Molecular Weight | 310.27 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | (2Z)-2-[(2,4-dinitrophenyl)hydrazinylidene]-3-methylpentanoic acid |
| SMILES | CCC(C)/C(=N/Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C12H14N4O6/c1-3-7(2)11(12(17)18)14-13-9-5-4-8(15(19)20)6-10(9)16(21)22/h4-7,13H,3H2,1-2H3,(H,17,18)/b14-11- |
| InChIKey | FRTLHACSPMJECM-KAMYIIQDSA-N |
| XLogP | 2.40 |
| TPSA | 147.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.27 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|