C26H30N8O12 — CID 71401456
diethyl 2,4-bis[N-(2,4-dinitroanilino)-C-methylcarbonimidoyl]-3-methylpentanedioate (PubChem CID 71401456) has the molecular formula C26H30N8O12 and a molecular weight of 646.57 g/mol. Its IUPAC name is diethyl 2,4-bis[N-(2,4-dinitroanilino)-C-methylcarbonimidoyl]-3-methylpentanedioate.
| Compound Name | diethyl 2,4-bis[N-(2,4-dinitroanilino)-C-methylcarbonimidoyl]-3-methylpentanedioate |
|---|---|
| PubChem CID | 71401456 |
| Molecular Formula | C26H30N8O12 |
| Molecular Weight | 646.57 g/mol |
| Exact Mass | 646.20 |
| IUPAC Name | diethyl 2,4-bis[N-(2,4-dinitroanilino)-C-methylcarbonimidoyl]-3-methylpentanedioate |
| SMILES | CCOC(=O)C(C(C)=NNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])C(C)C(C(=O)OCC)C(C)=NNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H30N8O12/c1-6-45-25(35)23(15(4)27-29-19-10-8-17(31(37)38)12-21(19)33(41)42)14(3)24(26(36)46-7-2)16(5)28-30-20-11-9-18(32(39)40)13-22(20)34(43)44/h8-14,23-24,29-30H,6-7H2,1-5H3 |
| InChIKey | RMBFHCOBMSISDT-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 273.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.57 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|