C13H16N4O6 — CID 43835354
ethyl (3E)-3-[(2,4-dinitrophenyl)hydrazinylidene]pentanoate (PubChem CID 43835354) has the molecular formula C13H16N4O6 and a molecular weight of 324.29 g/mol. Its IUPAC name is ethyl (3E)-3-[(2,4-dinitrophenyl)hydrazinylidene]pentanoate.
| Compound Name | ethyl (3E)-3-[(2,4-dinitrophenyl)hydrazinylidene]pentanoate |
|---|---|
| PubChem CID | 43835354 |
| Molecular Formula | C13H16N4O6 |
| Molecular Weight | 324.29 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | ethyl (3E)-3-[(2,4-dinitrophenyl)hydrazinylidene]pentanoate |
| SMILES | CCOC(=O)C/C(CC)=N/Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H16N4O6/c1-3-9(7-13(18)23-4-2)14-15-11-6-5-10(16(19)20)8-12(11)17(21)22/h5-6,8,15H,3-4,7H2,1-2H3/b14-9+ |
| InChIKey | TZSYZGZROAIVOP-NTEUORMPSA-N |
| XLogP | 2.63 |
| TPSA | 136.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.29 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|