C15H20N4O6 — CID 40557519
ethyl (2R)-2-[(Z)-N-(2,4-dinitroanilino)-C-methylcarbonimidoyl]pentanoate (PubChem CID 40557519) has the molecular formula C15H20N4O6 and a molecular weight of 352.35 g/mol. Its IUPAC name is ethyl (2R)-2-[(Z)-N-(2,4-dinitroanilino)-C-methylcarbonimidoyl]pentanoate.
| Compound Name | ethyl (2R)-2-[(Z)-N-(2,4-dinitroanilino)-C-methylcarbonimidoyl]pentanoate |
|---|---|
| PubChem CID | 40557519 |
| Molecular Formula | C15H20N4O6 |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | ethyl (2R)-2-[(Z)-N-(2,4-dinitroanilino)-C-methylcarbonimidoyl]pentanoate |
| SMILES | CCC[C@@H](C(=O)OCC)/C(C)=N\Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H20N4O6/c1-4-6-12(15(20)25-5-2)10(3)16-17-13-8-7-11(18(21)22)9-14(13)19(23)24/h7-9,12,17H,4-6H2,1-3H3/b16-10-/t12-/m1/s1 |
| InChIKey | DKHVYXDFQROUEW-YUSFRKCESA-N |
| XLogP | 3.27 |
| TPSA | 136.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|