C19H20N8O8 — CID 21233704
N-[(E)-[(6Z)-6-[(2,4-dinitrophenyl)hydrazinylidene]heptan-2-ylidene]amino]-2,4-dinitroaniline (PubChem CID 21233704) has the molecular formula C19H20N8O8 and a molecular weight of 488.42 g/mol. Its IUPAC name is N-[(E)-[(6Z)-6-[(2,4-dinitrophenyl)hydrazinylidene]heptan-2-ylidene]amino]-2,4-dinitroaniline.
| Compound Name | N-[(E)-[(6Z)-6-[(2,4-dinitrophenyl)hydrazinylidene]heptan-2-ylidene]amino]-2,4-dinitroaniline |
|---|---|
| PubChem CID | 21233704 |
| Molecular Formula | C19H20N8O8 |
| Molecular Weight | 488.42 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | N-[(E)-[(6Z)-6-[(2,4-dinitrophenyl)hydrazinylidene]heptan-2-ylidene]amino]-2,4-dinitroaniline |
| SMILES | C/C(CCC/C(C)=N/Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])=N/Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H20N8O8/c1-12(20-22-16-8-6-14(24(28)29)10-18(16)26(32)33)4-3-5-13(2)21-23-17-9-7-15(25(30)31)11-19(17)27(34)35/h6-11,22-23H,3-5H2,1-2H3/b20-12-,21-13+ |
| InChIKey | MIKWGVDAWBPWDP-AYRZQKSOSA-N |
| XLogP | 4.77 |
| TPSA | 221.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.42 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|