C17H24N4O6 — CID 177458536
methyl (2R,5E)-5-[(2,4-dinitrophenyl)hydrazinylidene]-2-methyl-2-propan-2-ylhexanoate (PubChem CID 177458536) has the molecular formula C17H24N4O6 and a molecular weight of 380.40 g/mol. Its IUPAC name is methyl (2R,5E)-5-[(2,4-dinitrophenyl)hydrazinylidene]-2-methyl-2-propan-2-ylhexanoate.
| Compound Name | methyl (2R,5E)-5-[(2,4-dinitrophenyl)hydrazinylidene]-2-methyl-2-propan-2-ylhexanoate |
|---|---|
| PubChem CID | 177458536 |
| Molecular Formula | C17H24N4O6 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | methyl (2R,5E)-5-[(2,4-dinitrophenyl)hydrazinylidene]-2-methyl-2-propan-2-ylhexanoate |
| SMILES | COC(=O)[C@](C)(CC/C(C)=N/Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])C(C)C |
| InChI | InChI=1S/C17H24N4O6/c1-11(2)17(4,16(22)27-5)9-8-12(3)18-19-14-7-6-13(20(23)24)10-15(14)21(25)26/h6-7,10-11,19H,8-9H2,1-5H3/b18-12+/t17-/m1/s1 |
| InChIKey | HAMQFGCTTRNEOA-YPOUMIDOSA-N |
| XLogP | 3.91 |
| TPSA | 136.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|