C16H20N4O6 — CID 177405616
(4R)-4-[(3E)-3-[(2,4-dinitrophenyl)hydrazinylidene]butyl]-5,5-dimethyloxolan-2-one (PubChem CID 177405616) has the molecular formula C16H20N4O6 and a molecular weight of 364.36 g/mol. Its IUPAC name is (4R)-4-[(3E)-3-[(2,4-dinitrophenyl)hydrazinylidene]butyl]-5,5-dimethyloxolan-2-one.
| Compound Name | (4R)-4-[(3E)-3-[(2,4-dinitrophenyl)hydrazinylidene]butyl]-5,5-dimethyloxolan-2-one |
|---|---|
| PubChem CID | 177405616 |
| Molecular Formula | C16H20N4O6 |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | (4R)-4-[(3E)-3-[(2,4-dinitrophenyl)hydrazinylidene]butyl]-5,5-dimethyloxolan-2-one |
| SMILES | C/C(CC[C@@H]1CC(=O)OC1(C)C)=N\Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H20N4O6/c1-10(4-5-11-8-15(21)26-16(11,2)3)17-18-13-7-6-12(19(22)23)9-14(13)20(24)25/h6-7,9,11,18H,4-5,8H2,1-3H3/b17-10+/t11-/m1/s1 |
| InChIKey | WAZJJMUPVAZFFO-JDAJCMJVSA-N |
| XLogP | 3.41 |
| TPSA | 136.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|