C12H16N4O6 — CID 6045361
(5Z)-5-[(2,4-dinitrophenyl)hydrazinylidene]hexane-2,3-diol (PubChem CID 6045361) has the molecular formula C12H16N4O6 and a molecular weight of 312.28 g/mol. Its IUPAC name is (5Z)-5-[(2,4-dinitrophenyl)hydrazinylidene]hexane-2,3-diol.
| Compound Name | (5Z)-5-[(2,4-dinitrophenyl)hydrazinylidene]hexane-2,3-diol |
|---|---|
| PubChem CID | 6045361 |
| Molecular Formula | C12H16N4O6 |
| Molecular Weight | 312.28 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | (5Z)-5-[(2,4-dinitrophenyl)hydrazinylidene]hexane-2,3-diol |
| SMILES | C/C(CC(O)C(C)O)=N/Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H16N4O6/c1-7(5-12(18)8(2)17)13-14-10-4-3-9(15(19)20)6-11(10)16(21)22/h3-4,6,8,12,14,17-18H,5H2,1-2H3/b13-7- |
| InChIKey | SPUZPBBMVWYSOY-QPEQYQDCSA-N |
| XLogP | 1.42 |
| TPSA | 151.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.28 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|