C18H23N5O7 — CID 11975467
methyl (2S)-1-[(2R,4Z)-4-[(2,4-dinitrophenyl)hydrazinylidene]-2-methylpentanoyl]pyrrolidine-2-carboxylate (PubChem CID 11975467) has the molecular formula C18H23N5O7 and a molecular weight of 421.41 g/mol. Its IUPAC name is methyl (2S)-1-[(2R,4Z)-4-[(2,4-dinitrophenyl)hydrazinylidene]-2-methylpentanoyl]pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S)-1-[(2R,4Z)-4-[(2,4-dinitrophenyl)hydrazinylidene]-2-methylpentanoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 11975467 |
| Molecular Formula | C18H23N5O7 |
| Molecular Weight | 421.41 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | methyl (2S)-1-[(2R,4Z)-4-[(2,4-dinitrophenyl)hydrazinylidene]-2-methylpentanoyl]pyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1CCCN1C(=O)[C@H](C)C/C(C)=N\Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H23N5O7/c1-11(17(24)21-8-4-5-15(21)18(25)30-3)9-12(2)19-20-14-7-6-13(22(26)27)10-16(14)23(28)29/h6-7,10-11,15,20H,4-5,8-9H2,1-3H3/b19-12-/t11-,15+/m1/s1 |
| InChIKey | BUOXIVMXVKZABM-IEQQPHEQSA-N |
| XLogP | 2.48 |
| TPSA | 157.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.41 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|