C12H13N3O6 — CID 12826384
methyl (2S)-1-(2,4-dinitrophenyl)pyrrolidine-2-carboxylate (PubChem CID 12826384) has the molecular formula C12H13N3O6 and a molecular weight of 295.25 g/mol. Its IUPAC name is methyl (2S)-1-(2,4-dinitrophenyl)pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S)-1-(2,4-dinitrophenyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 12826384 |
| Molecular Formula | C12H13N3O6 |
| Molecular Weight | 295.25 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | methyl (2S)-1-(2,4-dinitrophenyl)pyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1CCCN1c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H13N3O6/c1-21-12(16)10-3-2-6-13(10)9-5-4-8(14(17)18)7-11(9)15(19)20/h4-5,7,10H,2-3,6H2,1H3/t10-/m0/s1 |
| InChIKey | SLQCEFKHJIDSBB-JTQLQIEISA-N |
| XLogP | 1.64 |
| TPSA | 115.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.25 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|