About methyl (2S)-1-(2,4-dinitrophenyl)-4-(4-methylphenyl)sulfonyloxypyrrolidine-2-carboxylate
methyl (2S)-1-(2,4-dinitrophenyl)-4-(4-methylphenyl)sulfonyloxypyrrolidine-2-carboxylate (PubChem CID 57370322) has the molecular formula C19H19N3O9S
and a molecular weight of 465.44 g/mol. Its IUPAC name is methyl (2S)-1-(2,4-dinitrophenyl)-4-(4-methylphenyl)sulfonyloxypyrrolidine-2-carboxylate.
Molecular Properties
| Compound Name | methyl (2S)-1-(2,4-dinitrophenyl)-4-(4-methylphenyl)sulfonyloxypyrrolidine-2-carboxylate |
| PubChem CID | 57370322 |
| Molecular Formula | C19H19N3O9S |
| Molecular Weight | 465.44 g/mol |
| Exact Mass | 465.08 |
| IUPAC Name | methyl (2S)-1-(2,4-dinitrophenyl)-4-(4-methylphenyl)sulfonyloxypyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1CC(OS(=O)(=O)c2ccc(C)cc2)CN1c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H19N3O9S/c1-12-3-6-15(7-4-12)32(28,29)31-14-10-18(19(23)30-2)20(11-14)16-8-5-13(21(24)25)9-17(16)22(26)27/h3-9,14,18H,10-11H2,1-2H3/t14?,18-/m0/s1 |
| InChIKey | GGDHRBZBKSCHGZ-IBYPIGCZSA-N |
| XLogP | 2.34 |
| TPSA | 159.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 465.44 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze methyl (2S)-1-(2,4-dinitrophenyl)-4-(4-methylphenyl)sulfonyloxypyrrolidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S)-1-(2,4-dinitrophenyl)-4-(4-methylphenyl)sulfonyloxypyrrolidine-2-carboxylate?
The IUPAC name of methyl (2S)-1-(2,4-dinitrophenyl)-4-(4-methylphenyl)sulfonyloxypyrrolidine-2-carboxylate (CID 57370322) is methyl (2S)-1-(2,4-dinitrophenyl)-4-(4-methylphenyl)sulfonyloxypyrrolidine-2-carboxylate.
What is the SMILES notation for methyl (2S)-1-(2,4-dinitrophenyl)-4-(4-methylphenyl)sulfonyloxypyrrolidine-2-carboxylate?
The canonical SMILES for methyl (2S)-1-(2,4-dinitrophenyl)-4-(4-methylphenyl)sulfonyloxypyrrolidine-2-carboxylate is COC(=O)[C@@H]1CC(OS(=O)(=O)c2ccc(C)cc2)CN1c1ccc([N+](=O)[O-])cc1[N+](=O)[O-].
What is the InChIKey of methyl (2S)-1-(2,4-dinitrophenyl)-4-(4-methylphenyl)sulfonyloxypyrrolidine-2-carboxylate?
The InChIKey is GGDHRBZBKSCHGZ-IBYPIGCZSA-N. The full InChI is InChI=1S/C19H19N3O9S/c1-12-3-6-15(7-4-12)32(28,29)31-14-10-18(19(23)30-2)20(11-14)16-8-5-13(21(24)25)9-17(16)22(26)27/h3-9,14,18H,10-11H2,1-2H3/t14?,18-/m0/s1.
What are the key properties of methyl (2S)-1-(2,4-dinitrophenyl)-4-(4-methylphenyl)sulfonyloxypyrrolidine-2-carboxylate?
methyl (2S)-1-(2,4-dinitrophenyl)-4-(4-methylphenyl)sulfonyloxypyrrolidine-2-carboxylate has a molecular weight of 465.44 g/mol, XLogP of 2.34, 7 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-1-(2,4-dinitrophenyl)-4-(4-methylphenyl)sulfonyloxypyrrolidine-2-carboxylate is sourced from PubChem (CID 57370322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).