C15H19NO7S — CID 21132744
dimethyl 4-(4-methylphenyl)sulfonyloxypyrrolidine-1,2-dicarboxylate (PubChem CID 21132744) has the molecular formula C15H19NO7S and a molecular weight of 357.38 g/mol. Its IUPAC name is dimethyl 4-(4-methylphenyl)sulfonyloxypyrrolidine-1,2-dicarboxylate.
| Compound Name | dimethyl 4-(4-methylphenyl)sulfonyloxypyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 21132744 |
| Molecular Formula | C15H19NO7S |
| Molecular Weight | 357.38 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | dimethyl 4-(4-methylphenyl)sulfonyloxypyrrolidine-1,2-dicarboxylate |
| SMILES | COC(=O)C1CC(OS(=O)(=O)c2ccc(C)cc2)CN1C(=O)OC |
| InChI | InChI=1S/C15H19NO7S/c1-10-4-6-12(7-5-10)24(19,20)23-11-8-13(14(17)21-2)16(9-11)15(18)22-3/h4-7,11,13H,8-9H2,1-3H3 |
| InChIKey | SBCLVMDNZIQURE-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.38 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|