C14H19NO5S — CID 159587212
methyl (2S,4S)-1-methyl-4-(4-methylphenyl)sulfonyloxypyrrolidine-2-carboxylate (PubChem CID 159587212) has the molecular formula C14H19NO5S and a molecular weight of 313.38 g/mol. Its IUPAC name is methyl (2S,4S)-1-methyl-4-(4-methylphenyl)sulfonyloxypyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,4S)-1-methyl-4-(4-methylphenyl)sulfonyloxypyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 159587212 |
| Molecular Formula | C14H19NO5S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | methyl (2S,4S)-1-methyl-4-(4-methylphenyl)sulfonyloxypyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@H](OS(=O)(=O)c2ccc(C)cc2)CN1C |
| InChI | InChI=1S/C14H19NO5S/c1-10-4-6-12(7-5-10)21(17,18)20-11-8-13(14(16)19-3)15(2)9-11/h4-7,11,13H,8-9H2,1-3H3/t11-,13-/m0/s1 |
| InChIKey | ITGZZGFZBCFGFV-AAEUAGOBSA-N |
| XLogP | 0.95 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|