C16H20O5S — CID 11889227
methyl (1S,2S,4R,6R)-6-(4-methylphenyl)sulfonyloxybicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 11889227) has the molecular formula C16H20O5S and a molecular weight of 324.40 g/mol. Its IUPAC name is methyl (1S,2S,4R,6R)-6-(4-methylphenyl)sulfonyloxybicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | methyl (1S,2S,4R,6R)-6-(4-methylphenyl)sulfonyloxybicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 11889227 |
| Molecular Formula | C16H20O5S |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | methyl (1S,2S,4R,6R)-6-(4-methylphenyl)sulfonyloxybicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | COC(=O)[C@H]1C[C@H]2C[C@@H]1[C@H](OS(=O)(=O)c1ccc(C)cc1)C2 |
| InChI | InChI=1S/C16H20O5S/c1-10-3-5-12(6-4-10)22(18,19)21-15-9-11-7-13(15)14(8-11)16(17)20-2/h3-6,11,13-15H,7-9H2,1-2H3/t11-,13+,14+,15-/m1/s1 |
| InChIKey | TZTQRSNAEGJCTL-UQOMUDLDSA-N |
| XLogP | 2.29 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|