C15H18O3S — CID 98163781
[(1S,2S,3R,5R,6S)-3-tricyclo[4.2.0.02,5]octanyl] 4-methylbenzenesulfonate (PubChem CID 98163781) has the molecular formula C15H18O3S and a molecular weight of 278.37 g/mol. Its IUPAC name is [(1S,2S,3R,5R,6S)-3-tricyclo[4.2.0.02,5]octanyl] 4-methylbenzenesulfonate.
| Compound Name | [(1S,2S,3R,5R,6S)-3-tricyclo[4.2.0.02,5]octanyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 98163781 |
| Molecular Formula | C15H18O3S |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | [(1S,2S,3R,5R,6S)-3-tricyclo[4.2.0.02,5]octanyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@@H]2C[C@@H]3[C@H]4CC[C@@H]4[C@@H]32)cc1 |
| InChI | InChI=1S/C15H18O3S/c1-9-2-4-10(5-3-9)19(16,17)18-14-8-13-11-6-7-12(11)15(13)14/h2-5,11-15H,6-8H2,1H3/t11-,12-,13+,14+,15-/m0/s1 |
| InChIKey | PWROZVJTPAXOPA-AHDPXTMNSA-N |
| XLogP | 2.74 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|