C14H16O4S — CID 13072832
[(1R,2S,4R,5S)-3-oxatricyclo[3.2.1.02,4]octan-8-yl] 4-methylbenzenesulfonate (PubChem CID 13072832) has the molecular formula C14H16O4S and a molecular weight of 280.35 g/mol. Its IUPAC name is [(1R,2S,4R,5S)-3-oxatricyclo[3.2.1.02,4]octan-8-yl] 4-methylbenzenesulfonate.
| Compound Name | [(1R,2S,4R,5S)-3-oxatricyclo[3.2.1.02,4]octan-8-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 13072832 |
| Molecular Formula | C14H16O4S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | [(1R,2S,4R,5S)-3-oxatricyclo[3.2.1.02,4]octan-8-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC2[C@H]3CC[C@@H]2[C@@H]2O[C@@H]23)cc1 |
| InChI | InChI=1S/C14H16O4S/c1-8-2-4-9(5-3-8)19(15,16)18-12-10-6-7-11(12)14-13(10)17-14/h2-5,10-14H,6-7H2,1H3/t10-,11+,12?,13-,14+ |
| InChIKey | KTOPMQAKNWRIOD-LSPKCERGSA-N |
| XLogP | 1.88 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|