C14H20O4S — CID 87133597
[(2R,6R)-2,6-dimethyloxan-4-yl] 4-methylbenzenesulfonate (PubChem CID 87133597) has the molecular formula C14H20O4S and a molecular weight of 284.38 g/mol. Its IUPAC name is [(2R,6R)-2,6-dimethyloxan-4-yl] 4-methylbenzenesulfonate.
| Compound Name | [(2R,6R)-2,6-dimethyloxan-4-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87133597 |
| Molecular Formula | C14H20O4S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | [(2R,6R)-2,6-dimethyloxan-4-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC2C[C@@H](C)O[C@H](C)C2)cc1 |
| InChI | InChI=1S/C14H20O4S/c1-10-4-6-14(7-5-10)19(15,16)18-13-8-11(2)17-12(3)9-13/h4-7,11-13H,8-9H2,1-3H3/t11-,12-/m1/s1 |
| InChIKey | ILQVKNFSWITXAN-VXGBXAGGSA-N |
| XLogP | 2.66 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|