C15H21NO3S2 — CID 87547931
(3-thiomorpholin-4-ylcyclobutyl) 4-methylbenzenesulfonate (PubChem CID 87547931) has the molecular formula C15H21NO3S2 and a molecular weight of 327.47 g/mol. Its IUPAC name is (3-thiomorpholin-4-ylcyclobutyl) 4-methylbenzenesulfonate.
| Compound Name | (3-thiomorpholin-4-ylcyclobutyl) 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87547931 |
| Molecular Formula | C15H21NO3S2 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | (3-thiomorpholin-4-ylcyclobutyl) 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC2CC(N3CCSCC3)C2)cc1 |
| InChI | InChI=1S/C15H21NO3S2/c1-12-2-4-15(5-3-12)21(17,18)19-14-10-13(11-14)16-6-8-20-9-7-16/h2-5,13-14H,6-11H2,1H3 |
| InChIKey | JJEFIKUUFYADQR-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|