C15H17BrN2O3S — CID 168945269
[3-(4-bromopyrazol-1-yl)cyclopentyl] 4-methylbenzenesulfonate (PubChem CID 168945269) has the molecular formula C15H17BrN2O3S and a molecular weight of 385.28 g/mol. Its IUPAC name is [3-(4-bromopyrazol-1-yl)cyclopentyl] 4-methylbenzenesulfonate.
| Compound Name | [3-(4-bromopyrazol-1-yl)cyclopentyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 168945269 |
| Molecular Formula | C15H17BrN2O3S |
| Molecular Weight | 385.28 g/mol |
| Exact Mass | 384.01 |
| IUPAC Name | [3-(4-bromopyrazol-1-yl)cyclopentyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC2CCC(n3cc(Br)cn3)C2)cc1 |
| InChI | InChI=1S/C15H17BrN2O3S/c1-11-2-6-15(7-3-11)22(19,20)21-14-5-4-13(8-14)18-10-12(16)9-17-18/h2-3,6-7,9-10,13-14H,4-5,8H2,1H3 |
| InChIKey | ORNCDEGOIBEEEC-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.28 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|