C18H22N2O4S — CID 87147417
[4-(5-methylpyrimidin-2-yl)oxycyclohexyl] 4-methylbenzenesulfonate (PubChem CID 87147417) has the molecular formula C18H22N2O4S and a molecular weight of 362.45 g/mol. Its IUPAC name is [4-(5-methylpyrimidin-2-yl)oxycyclohexyl] 4-methylbenzenesulfonate.
| Compound Name | [4-(5-methylpyrimidin-2-yl)oxycyclohexyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87147417 |
| Molecular Formula | C18H22N2O4S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | [4-(5-methylpyrimidin-2-yl)oxycyclohexyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC2CCC(Oc3ncc(C)cn3)CC2)cc1 |
| InChI | InChI=1S/C18H22N2O4S/c1-13-3-9-17(10-4-13)25(21,22)24-16-7-5-15(6-8-16)23-18-19-11-14(2)12-20-18/h3-4,9-12,15-16H,5-8H2,1-2H3 |
| InChIKey | LMSSTKUFBGNJFP-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|