C21H26O6S2 — CID 118071883
[4-methyl-4-(4-methylphenyl)sulfonyloxycyclohexyl] 4-methylbenzenesulfonate (PubChem CID 118071883) has the molecular formula C21H26O6S2 and a molecular weight of 438.57 g/mol. Its IUPAC name is [4-methyl-4-(4-methylphenyl)sulfonyloxycyclohexyl] 4-methylbenzenesulfonate.
| Compound Name | [4-methyl-4-(4-methylphenyl)sulfonyloxycyclohexyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 118071883 |
| Molecular Formula | C21H26O6S2 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | [4-methyl-4-(4-methylphenyl)sulfonyloxycyclohexyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC2CCC(C)(OS(=O)(=O)c3ccc(C)cc3)CC2)cc1 |
| InChI | InChI=1S/C21H26O6S2/c1-16-4-8-19(9-5-16)28(22,23)26-18-12-14-21(3,15-13-18)27-29(24,25)20-10-6-17(2)7-11-20/h4-11,18H,12-15H2,1-3H3 |
| InChIKey | RBVCWGPJQXKLSH-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|